C15H24FNO — CID 170732937
(2E,4E)-N-butyl-5-fluoro-2-[(E)-2-methylbut-1-enyl]hexa-2,4-dienamide (PubChem CID 170732937) has the molecular formula C15H24FNO and a molecular weight of 253.36 g/mol. Its IUPAC name is (2E,4E)-N-butyl-5-fluoro-2-[(E)-2-methylbut-1-enyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-butyl-5-fluoro-2-[(E)-2-methylbut-1-enyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 170732937 |
| Molecular Formula | C15H24FNO |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (2E,4E)-N-butyl-5-fluoro-2-[(E)-2-methylbut-1-enyl]hexa-2,4-dienamide |
| SMILES | CCCCNC(=O)C(/C=C(\C)CC)=C/C=C(\C)F |
| InChI | InChI=1S/C15H24FNO/c1-5-7-10-17-15(18)14(9-8-13(4)16)11-12(3)6-2/h8-9,11H,5-7,10H2,1-4H3,(H,17,18)/b12-11+,13-8+,14-9+ |
| InChIKey | JWYNGPRRZWEYLS-MJPPZECFSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|