C16H16F6N4O4S — CID 170733458
N-[6-(2,2-difluoroethoxy)-5-fluoro-2-methoxy-3-pyridinyl]-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 170733458) has the molecular formula C16H16F6N4O4S and a molecular weight of 474.38 g/mol. Its IUPAC name is N-[6-(2,2-difluoroethoxy)-5-fluoro-2-methoxy-3-pyridinyl]-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | N-[6-(2,2-difluoroethoxy)-5-fluoro-2-methoxy-3-pyridinyl]-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 170733458 |
| Molecular Formula | C16H16F6N4O4S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | N-[6-(2,2-difluoroethoxy)-5-fluoro-2-methoxy-3-pyridinyl]-7-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | COc1nc(OCC(F)F)c(F)cc1NS(=O)(=O)c1cnc2n1CCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C16H16F6N4O4S/c1-29-15-10(5-9(17)14(24-15)30-7-11(18)19)25-31(27,28)13-6-23-12-4-8(16(20,21)22)2-3-26(12)13/h5-6,8,11,25H,2-4,7H2,1H3 |
| InChIKey | OVXJWYBRNDOGJL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |