C23H28FN3O — CID 170734713
4-[[(1E,3Z)-1-amino-5-[1-(2-methylprop-2-enyl)piperidin-4-yl]hexa-1,3,5-trienoxy]methyl]-3-fluorobenzonitrile (PubChem CID 170734713) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is 4-[[(1E,3Z)-1-amino-5-[1-(2-methylprop-2-enyl)piperidin-4-yl]hexa-1,3,5-trienoxy]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[(1E,3Z)-1-amino-5-[1-(2-methylprop-2-enyl)piperidin-4-yl]hexa-1,3,5-trienoxy]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 170734713 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-[[(1E,3Z)-1-amino-5-[1-(2-methylprop-2-enyl)piperidin-4-yl]hexa-1,3,5-trienoxy]methyl]-3-fluorobenzonitrile |
| SMILES | C=C(C)CN1CCC(C(=C)/C=C\C=C(/N)OCc2ccc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C23H28FN3O/c1-17(2)15-27-11-9-20(10-12-27)18(3)5-4-6-23(26)28-16-21-8-7-19(14-25)13-22(21)24/h4-8,13,20H,1,3,9-12,15-16,26H2,2H3/b5-4-,23-6+ |
| InChIKey | UJEVXXCOWSDWIK-ZLOKIHLYSA-N |
| XLogP | 4.41 |
| TPSA | 62.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|