About 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol
7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol (PubChem CID 170735823) has the molecular formula C21H43NO4
and a molecular weight of 373.58 g/mol. Its IUPAC name is 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol.
Molecular Properties
| Compound Name | 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol |
| PubChem CID | 170735823 |
| Molecular Formula | C21H43NO4 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol |
| SMILES | OCCCCCCC(O)(CCCCCCO)CCCCN1CCOCC1 |
| InChI | InChI=1S/C21H43NO4/c23-17-9-3-1-5-11-21(25,12-6-2-4-10-18-24)13-7-8-14-22-15-19-26-20-16-22/h23-25H,1-20H2 |
| InChIKey | ICVDVFDQGVGNEL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol?
The IUPAC name of 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol (CID 170735823) is 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol.
What is the SMILES notation for 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol?
The canonical SMILES for 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol is OCCCCCCC(O)(CCCCCCO)CCCCN1CCOCC1.
What is the InChIKey of 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol?
The InChIKey is ICVDVFDQGVGNEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43NO4/c23-17-9-3-1-5-11-21(25,12-6-2-4-10-18-24)13-7-8-14-22-15-19-26-20-16-22/h23-25H,1-20H2.
What are the key properties of 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol?
7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol has a molecular weight of 373.58 g/mol, XLogP of 3.11, 17 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-morpholin-4-ylbutyl)tridecane-1,7,13-triol is sourced from PubChem (CID 170735823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).