C22H23F3N2O — CID 170736195
(E)-4-(dimethylamino)-1-[7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]but-2-en-1-one (PubChem CID 170736195) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 170736195 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[7-[4-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinolin-2-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCc2ccc(-c3ccc(C(F)(F)F)cc3)cc2C1 |
| InChI | InChI=1S/C22H23F3N2O/c1-26(2)12-3-4-21(28)27-13-11-17-5-6-18(14-19(17)15-27)16-7-9-20(10-8-16)22(23,24)25/h3-10,14H,11-13,15H2,1-2H3/b4-3+ |
| InChIKey | NJSMJSMPAIRNSE-ONEGZZNKSA-N |
| XLogP | 4.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|