About [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate
[1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate (PubChem CID 170736522) has the molecular formula C15H20BrNO2
and a molecular weight of 326.23 g/mol. Its IUPAC name is [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate.
Molecular Properties
| Compound Name | [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate |
| PubChem CID | 170736522 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate |
| SMILES | CC(=O)OC1(C)CN(Cc2cc(C)c(Br)cc2C)C1 |
| InChI | InChI=1S/C15H20BrNO2/c1-10-6-14(16)11(2)5-13(10)7-17-8-15(4,9-17)19-12(3)18/h5-6H,7-9H2,1-4H3 |
| InChIKey | BKFBZLVZUJQROK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate?
The IUPAC name of [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate (CID 170736522) is [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate.
What is the SMILES notation for [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate?
The canonical SMILES for [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate is CC(=O)OC1(C)CN(Cc2cc(C)c(Br)cc2C)C1.
What is the InChIKey of [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate?
The InChIKey is BKFBZLVZUJQROK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO2/c1-10-6-14(16)11(2)5-13(10)7-17-8-15(4,9-17)19-12(3)18/h5-6H,7-9H2,1-4H3.
What are the key properties of [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate?
[1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate has a molecular weight of 326.23 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-bromo-2,5-dimethylphenyl)methyl]-3-methylazetidin-3-yl] acetate is sourced from PubChem (CID 170736522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).