About [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate
[1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate (PubChem CID 170737275) has the molecular formula C12H13BrF2O3S
and a molecular weight of 355.20 g/mol. Its IUPAC name is [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate |
| PubChem CID | 170737275 |
| Molecular Formula | C12H13BrF2O3S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1(c2cccc(Br)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C12H13BrF2O3S/c1-19(16,17)18-8-11(6-12(14,15)7-11)9-3-2-4-10(13)5-9/h2-5H,6-8H2,1H3 |
| InChIKey | XRAWDTUXSVDPCW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate?
The IUPAC name of [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate (CID 170737275) is [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate.
What is the SMILES notation for [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate?
The canonical SMILES for [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate is CS(=O)(=O)OCC1(c2cccc(Br)c2)CC(F)(F)C1.
What is the InChIKey of [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate?
The InChIKey is XRAWDTUXSVDPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrF2O3S/c1-19(16,17)18-8-11(6-12(14,15)7-11)9-3-2-4-10(13)5-9/h2-5H,6-8H2,1H3.
What are the key properties of [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate?
[1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate has a molecular weight of 355.20 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-bromophenyl)-3,3-difluorocyclobutyl]methyl methanesulfonate is sourced from PubChem (CID 170737275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).