C15H17F2N3O2 — CID 170737571
1-[4-(3,3-difluoropiperidin-4-yl)phenyl]-1,3-diazinane-2,4-dione (PubChem CID 170737571) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-[4-(3,3-difluoropiperidin-4-yl)phenyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[4-(3,3-difluoropiperidin-4-yl)phenyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 170737571 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-[4-(3,3-difluoropiperidin-4-yl)phenyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2ccc(C3CCNCC3(F)F)cc2)C(=O)N1 |
| InChI | InChI=1S/C15H17F2N3O2/c16-15(17)9-18-7-5-12(15)10-1-3-11(4-2-10)20-8-6-13(21)19-14(20)22/h1-4,12,18H,5-9H2,(H,19,21,22) |
| InChIKey | ZGPFXHNJRLJZDV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |