About 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine
3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine (PubChem CID 170737745) has the molecular formula C18H26N2O2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine.
Molecular Properties
| Compound Name | 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine |
| PubChem CID | 170737745 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine |
| SMILES | CC1(c2ccccc2)CCC(=O)NC1=O.CC1CCCCN1 |
| InChI | InChI=1S/C12H13NO2.C6H13N/c1-12(9-5-3-2-4-6-9)8-7-10(14)13-11(12)15;1-6-4-2-3-5-7-6/h2-6H,7-8H2,1H3,(H,13,14,15);6-7H,2-5H2,1H3 |
| InChIKey | AEKRZJRAOKTMNR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine?
The IUPAC name of 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine (CID 170737745) is 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine.
What is the SMILES notation for 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine?
The canonical SMILES for 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine is CC1(c2ccccc2)CCC(=O)NC1=O.CC1CCCCN1.
What is the InChIKey of 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine?
The InChIKey is AEKRZJRAOKTMNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2.C6H13N/c1-12(9-5-3-2-4-6-9)8-7-10(14)13-11(12)15;1-6-4-2-3-5-7-6/h2-6H,7-8H2,1H3,(H,13,14,15);6-7H,2-5H2,1H3.
What are the key properties of 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine?
3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine has a molecular weight of 302.42 g/mol, XLogP of 2.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-phenylpiperidine-2,6-dione;2-methylpiperidine is sourced from PubChem (CID 170737745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).