C25H38N4O3 — CID 170737766
N-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide;methylcyclohexane (PubChem CID 170737766) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide;methylcyclohexane.
| Compound Name | N-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide;methylcyclohexane |
|---|---|
| PubChem CID | 170737766 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | N-[4-(2,6-dioxopiperidin-3-yl)phenyl]-2-(4-methylpiperazin-1-yl)acetamide;methylcyclohexane |
| SMILES | CC1CCCCC1.CN1CCN(CC(=O)Nc2ccc(C3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C18H24N4O3.C7H14/c1-21-8-10-22(11-9-21)12-17(24)19-14-4-2-13(3-5-14)15-6-7-16(23)20-18(15)25;1-7-5-3-2-4-6-7/h2-5,15H,6-12H2,1H3,(H,19,24)(H,20,23,25);7H,2-6H2,1H3 |
| InChIKey | WPJJCKPBUAWKMO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|