C15H11N7O2 — CID 170737835
1-[4-(cyclopropylamino)-5-nitro-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 170737835) has the molecular formula C15H11N7O2 and a molecular weight of 321.30 g/mol. Its IUPAC name is 1-[4-(cyclopropylamino)-5-nitro-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 1-[4-(cyclopropylamino)-5-nitro-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 170737835 |
| Molecular Formula | C15H11N7O2 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 1-[4-(cyclopropylamino)-5-nitro-2-pyridinyl]pyrazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cnc2c(cnn2-c2cc(NC3CC3)c([N+](=O)[O-])cn2)c1 |
| InChI | InChI=1S/C15H11N7O2/c16-5-9-3-10-7-19-21(15(10)18-6-9)14-4-12(20-11-1-2-11)13(8-17-14)22(23)24/h3-4,6-8,11H,1-2H2,(H,17,20) |
| InChIKey | ZCLWHTFLPWKGOF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|