About ethane;1-ethyl-2,6-dimethylpiperazine
ethane;1-ethyl-2,6-dimethylpiperazine (PubChem CID 170737878) has the molecular formula C12H30N2
and a molecular weight of 202.39 g/mol. Its IUPAC name is ethane;1-ethyl-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | ethane;1-ethyl-2,6-dimethylpiperazine |
| PubChem CID | 170737878 |
| Molecular Formula | C12H30N2 |
| Molecular Weight | 202.39 g/mol |
| Exact Mass | 202.24 |
| IUPAC Name | ethane;1-ethyl-2,6-dimethylpiperazine |
| SMILES | CC.CC.CCN1C(C)CNCC1C |
| InChI | InChI=1S/C8H18N2.2C2H6/c1-4-10-7(2)5-9-6-8(10)3;2*1-2/h7-9H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | IXUZYJFUKNGPAC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethyl-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-2,6-dimethylpiperazine?
The IUPAC name of ethane;1-ethyl-2,6-dimethylpiperazine (CID 170737878) is ethane;1-ethyl-2,6-dimethylpiperazine.
What is the SMILES notation for ethane;1-ethyl-2,6-dimethylpiperazine?
The canonical SMILES for ethane;1-ethyl-2,6-dimethylpiperazine is CC.CC.CCN1C(C)CNCC1C.
What is the InChIKey of ethane;1-ethyl-2,6-dimethylpiperazine?
The InChIKey is IXUZYJFUKNGPAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.2C2H6/c1-4-10-7(2)5-9-6-8(10)3;2*1-2/h7-9H,4-6H2,1-3H3;2*1-2H3.
What are the key properties of ethane;1-ethyl-2,6-dimethylpiperazine?
ethane;1-ethyl-2,6-dimethylpiperazine has a molecular weight of 202.39 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-2,6-dimethylpiperazine is sourced from PubChem (CID 170737878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).