About acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium
acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium (PubChem CID 170738871) has the molecular formula C15H16N3O5+
and a molecular weight of 318.31 g/mol. Its IUPAC name is acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium.
Molecular Properties
| Compound Name | acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium |
| PubChem CID | 170738871 |
| Molecular Formula | C15H16N3O5+ |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium |
| SMILES | CC(=O)[N+](C)(C)c1cc(N2C(=O)C=CC2=O)cc(C(N)=O)c1O |
| InChI | InChI=1S/C15H15N3O5/c1-8(19)18(2,3)11-7-9(6-10(14(11)22)15(16)23)17-12(20)4-5-13(17)21/h4-7H,1-3H3,(H2-,16,22,23)/p+1 |
| InChIKey | WBOQEWHQHIJRMW-UHFFFAOYSA-O |
| XLogP | 0.03 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium?
The IUPAC name of acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium (CID 170738871) is acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium.
What is the SMILES notation for acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium?
The canonical SMILES for acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium is CC(=O)[N+](C)(C)c1cc(N2C(=O)C=CC2=O)cc(C(N)=O)c1O.
What is the InChIKey of acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium?
The InChIKey is WBOQEWHQHIJRMW-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H15N3O5/c1-8(19)18(2,3)11-7-9(6-10(14(11)22)15(16)23)17-12(20)4-5-13(17)21/h4-7H,1-3H3,(H2-,16,22,23)/p+1.
What are the key properties of acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium?
acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium has a molecular weight of 318.31 g/mol, XLogP of 0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl-[3-carbamoyl-5-(2,5-dioxopyrrol-1-yl)-2-hydroxyphenyl]-dimethylazanium is sourced from PubChem (CID 170738871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).