C26H33FO6 — CID 170739013
(1S,4R,6R,8S,9S,11S,12R,13S)-6-cyclobutyl-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 170739013) has the molecular formula C26H33FO6 and a molecular weight of 460.54 g/mol. Its IUPAC name is (1S,4R,6R,8S,9S,11S,12R,13S)-6-cyclobutyl-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,4R,6R,8S,9S,11S,12R,13S)-6-cyclobutyl-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 170739013 |
| Molecular Formula | C26H33FO6 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (1S,4R,6R,8S,9S,11S,12R,13S)-6-cyclobutyl-12-fluoro-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C[C@]12C=CC(=O)C=C1CC[C@H]1C3C[C@H]4O[C@@H](C5CCC5)O[C@@]4(C(=O)CO)[C@@]3(C)C[C@H](O)[C@@]12F |
| InChI | InChI=1S/C26H33FO6/c1-23-9-8-16(29)10-15(23)6-7-17-18-11-21-26(20(31)13-28,33-22(32-21)14-4-3-5-14)24(18,2)12-19(30)25(17,23)27/h8-10,14,17-19,21-22,28,30H,3-7,11-13H2,1-2H3/t17-,18?,19-,21+,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | DBAHGONPZBQBBD-NKBRGBOJSA-N |
| XLogP | 2.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |