C21H33FN4O2 — CID 170739246
2-[4-[2-[1-(5-acetyl-2-pyridinyl)pyrrolidin-3-yl]ethyl]piperazin-1-yl]acetyl fluoride;ethane (PubChem CID 170739246) has the molecular formula C21H33FN4O2 and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-[4-[2-[1-(5-acetyl-2-pyridinyl)pyrrolidin-3-yl]ethyl]piperazin-1-yl]acetyl fluoride;ethane.
| Compound Name | 2-[4-[2-[1-(5-acetyl-2-pyridinyl)pyrrolidin-3-yl]ethyl]piperazin-1-yl]acetyl fluoride;ethane |
|---|---|
| PubChem CID | 170739246 |
| Molecular Formula | C21H33FN4O2 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-[4-[2-[1-(5-acetyl-2-pyridinyl)pyrrolidin-3-yl]ethyl]piperazin-1-yl]acetyl fluoride;ethane |
| SMILES | CC.CC(=O)c1ccc(N2CCC(CCN3CCN(CC(=O)F)CC3)C2)nc1 |
| InChI | InChI=1S/C19H27FN4O2.C2H6/c1-15(25)17-2-3-19(21-12-17)24-7-5-16(13-24)4-6-22-8-10-23(11-9-22)14-18(20)26;1-2/h2-3,12,16H,4-11,13-14H2,1H3;1-2H3 |
| InChIKey | KGRVGAKFPBARDB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|