About 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile
3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile (PubChem CID 170740643) has the molecular formula C16H15BrF3N5
and a molecular weight of 414.23 g/mol. Its IUPAC name is 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile |
| PubChem CID | 170740643 |
| Molecular Formula | C16H15BrF3N5 |
| Molecular Weight | 414.23 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile |
| SMILES | Cn1cnnc1C1CCN(c2c(Br)cc(C(F)(F)F)cc2C#N)CC1 |
| InChI | InChI=1S/C16H15BrF3N5/c1-24-9-22-23-15(24)10-2-4-25(5-3-10)14-11(8-21)6-12(7-13(14)17)16(18,19)20/h6-7,9-10H,2-5H2,1H3 |
| InChIKey | BCQWRBBUUJHJAU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile?
The IUPAC name of 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile (CID 170740643) is 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile?
The canonical SMILES for 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile is Cn1cnnc1C1CCN(c2c(Br)cc(C(F)(F)F)cc2C#N)CC1.
What is the InChIKey of 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile?
The InChIKey is BCQWRBBUUJHJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrF3N5/c1-24-9-22-23-15(24)10-2-4-25(5-3-10)14-11(8-21)6-12(7-13(14)17)16(18,19)20/h6-7,9-10H,2-5H2,1H3.
What are the key properties of 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile?
3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile has a molecular weight of 414.23 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-[4-(4-methyl-1,2,4-triazol-3-yl)piperidin-1-yl]-5-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 170740643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).