C14H13FN6O2 — CID 170741277
methyl 11-fluoro-3-methyl-3-(2H-triazol-4-yl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate (PubChem CID 170741277) has the molecular formula C14H13FN6O2 and a molecular weight of 316.30 g/mol. Its IUPAC name is methyl 11-fluoro-3-methyl-3-(2H-triazol-4-yl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate.
| Compound Name | methyl 11-fluoro-3-methyl-3-(2H-triazol-4-yl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 170741277 |
| Molecular Formula | C14H13FN6O2 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | methyl 11-fluoro-3-methyl-3-(2H-triazol-4-yl)-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
| SMILES | COC(=O)C1CC(C)(c2cn[nH]n2)c2c1cnc1cc(F)nn21 |
| InChI | InChI=1S/C14H13FN6O2/c1-14(9-6-17-20-18-9)4-7(13(22)23-2)8-5-16-11-3-10(15)19-21(11)12(8)14/h3,5-7H,4H2,1-2H3,(H,17,18,20) |
| InChIKey | UXVMUHJCNXEVFI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |