C15H12F3N5O2 — CID 170741353
(3R)-3-[1-(difluoromethyl)pyrazol-4-yl]-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid (PubChem CID 170741353) has the molecular formula C15H12F3N5O2 and a molecular weight of 351.29 g/mol. Its IUPAC name is (3R)-3-[1-(difluoromethyl)pyrazol-4-yl]-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid.
| Compound Name | (3R)-3-[1-(difluoromethyl)pyrazol-4-yl]-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 170741353 |
| Molecular Formula | C15H12F3N5O2 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (3R)-3-[1-(difluoromethyl)pyrazol-4-yl]-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylic acid |
| SMILES | C[C@]1(c2cnn(C(F)F)c2)CC(C(=O)O)c2cnc3cc(F)nn3c21 |
| InChI | InChI=1S/C15H12F3N5O2/c1-15(7-4-20-22(6-7)14(17)18)3-8(13(24)25)9-5-19-11-2-10(16)21-23(11)12(9)15/h2,4-6,8,14H,3H2,1H3,(H,24,25)/t8?,15-/m1/s1 |
| InChIKey | WCBUJKDZZUBCNN-LXCSWDKBSA-N |
| XLogP | 2.34 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |