C17H18FN5O2 — CID 170741407
methyl 3-(1-ethylpyrazol-4-yl)-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate (PubChem CID 170741407) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is methyl 3-(1-ethylpyrazol-4-yl)-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate.
| Compound Name | methyl 3-(1-ethylpyrazol-4-yl)-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 170741407 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | methyl 3-(1-ethylpyrazol-4-yl)-11-fluoro-3-methyl-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-5-carboxylate |
| SMILES | CCn1cc(C2(C)CC(C(=O)OC)c3cnc4cc(F)nn4c32)cn1 |
| InChI | InChI=1S/C17H18FN5O2/c1-4-22-9-10(7-20-22)17(2)6-11(16(24)25-3)12-8-19-14-5-13(18)21-23(14)15(12)17/h5,7-9,11H,4,6H2,1-3H3 |
| InChIKey | RESMURQOIJLFMF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |