C30H44N6O8 — CID 170741541
6-(2,5-dioxopyrrol-1-yl)-N-ethylhexanamide;N-[2-(ethoxymethylamino)-2-oxoethyl]-2-[(2-formamidoacetyl)amino]-N-methyl-3-phenylpropanamide (PubChem CID 170741541) has the molecular formula C30H44N6O8 and a molecular weight of 616.72 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-ethylhexanamide;N-[2-(ethoxymethylamino)-2-oxoethyl]-2-[(2-formamidoacetyl)amino]-N-methyl-3-phenylpropanamide.
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-ethylhexanamide;N-[2-(ethoxymethylamino)-2-oxoethyl]-2-[(2-formamidoacetyl)amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 170741541 |
| Molecular Formula | C30H44N6O8 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.32 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-ethylhexanamide;N-[2-(ethoxymethylamino)-2-oxoethyl]-2-[(2-formamidoacetyl)amino]-N-methyl-3-phenylpropanamide |
| SMILES | CCNC(=O)CCCCCN1C(=O)C=CC1=O.CCOCNC(=O)CN(C)C(=O)C(Cc1ccccc1)NC(=O)CNC=O |
| InChI | InChI=1S/C18H26N4O5.C12H18N2O3/c1-3-27-13-20-17(25)11-22(2)18(26)15(21-16(24)10-19-12-23)9-14-7-5-4-6-8-14;1-2-13-10(15)6-4-3-5-9-14-11(16)7-8-12(14)17/h4-8,12,15H,3,9-11,13H2,1-2H3,(H,19,23)(H,20,25)(H,21,24);7-8H,2-6,9H2,1H3,(H,13,15) |
| InChIKey | RYQOILGYNRPMQB-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 183.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|