About 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile
6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile (PubChem CID 170742464) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile |
| PubChem CID | 170742464 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile |
| SMILES | CC(C)C1C=C(C#N)C=NN1 |
| InChI | InChI=1S/C8H11N3/c1-6(2)8-3-7(4-9)5-10-11-8/h3,5-6,8,11H,1-2H3 |
| InChIKey | VEAFYAHTCHOPJX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 48.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile?
The IUPAC name of 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile (CID 170742464) is 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile.
What is the SMILES notation for 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile?
The canonical SMILES for 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile is CC(C)C1C=C(C#N)C=NN1.
What is the InChIKey of 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile?
The InChIKey is VEAFYAHTCHOPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6(2)8-3-7(4-9)5-10-11-8/h3,5-6,8,11H,1-2H3.
What are the key properties of 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile?
6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile has a molecular weight of 149.20 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-1,6-dihydropyridazine-4-carbonitrile is sourced from PubChem (CID 170742464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).