C11H14BrF3O — CID 170742470
(3Z,5E)-3-bromo-4-ethoxy-6-(trifluoromethyl)octa-1,3,5-triene (PubChem CID 170742470) has the molecular formula C11H14BrF3O and a molecular weight of 299.13 g/mol. Its IUPAC name is (3Z,5E)-3-bromo-4-ethoxy-6-(trifluoromethyl)octa-1,3,5-triene.
| Compound Name | (3Z,5E)-3-bromo-4-ethoxy-6-(trifluoromethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 170742470 |
| Molecular Formula | C11H14BrF3O |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | (3Z,5E)-3-bromo-4-ethoxy-6-(trifluoromethyl)octa-1,3,5-triene |
| SMILES | C=C/C(Br)=C(\C=C(/CC)C(F)(F)F)OCC |
| InChI | InChI=1S/C11H14BrF3O/c1-4-8(11(13,14)15)7-10(16-6-3)9(12)5-2/h5,7H,2,4,6H2,1,3H3/b8-7+,10-9- |
| InChIKey | WERFZKQADCVHMD-GOJKSUSPSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|