C15H22O2 — CID 170742903
2-but-2-en-2-yl-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one (PubChem CID 170742903) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-but-2-en-2-yl-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one.
| Compound Name | 2-but-2-en-2-yl-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one |
|---|---|
| PubChem CID | 170742903 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 2-but-2-en-2-yl-4-ethyl-2,3,4,6,7,8-hexahydrochromen-5-one |
| SMILES | CC=C(C)C1CC(CC)C2=C(CCCC2=O)O1 |
| InChI | InChI=1S/C15H22O2/c1-4-10(3)14-9-11(5-2)15-12(16)7-6-8-13(15)17-14/h4,11,14H,5-9H2,1-3H3 |
| InChIKey | YFGZFRQFZAYPDW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|