C24H35NO2Si — CID 170744424
3-[tert-butyl(dimethyl)silyl]oxy-N,2,6,6,9-pentamethylbenzo[c]chromen-8-amine (PubChem CID 170744424) has the molecular formula C24H35NO2Si and a molecular weight of 397.64 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-N,2,6,6,9-pentamethylbenzo[c]chromen-8-amine.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-N,2,6,6,9-pentamethylbenzo[c]chromen-8-amine |
|---|---|
| PubChem CID | 170744424 |
| Molecular Formula | C24H35NO2Si |
| Molecular Weight | 397.64 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-N,2,6,6,9-pentamethylbenzo[c]chromen-8-amine |
| SMILES | CNc1cc2c(cc1C)-c1cc(C)c(O[Si](C)(C)C(C)(C)C)cc1OC2(C)C |
| InChI | InChI=1S/C24H35NO2Si/c1-15-11-17-18-12-16(2)21(27-28(9,10)23(3,4)5)14-22(18)26-24(6,7)19(17)13-20(15)25-8/h11-14,25H,1-10H3 |
| InChIKey | ASXMYSWYEVIRTL-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.64 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|