About N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide
N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide (PubChem CID 170744979) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide.
Molecular Properties
| Compound Name | N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide |
| PubChem CID | 170744979 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide |
| SMILES | C=C=CCC(=O)NCCCC[C@H](O)CO |
| InChI | InChI=1S/C11H19NO3/c1-2-3-7-11(15)12-8-5-4-6-10(14)9-13/h3,10,13-14H,1,4-9H2,(H,12,15)/t10-/m0/s1 |
| InChIKey | OXEIGFIRZLZNAV-JTQLQIEISA-N |
| XLogP | 0.36 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide?
The IUPAC name of N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide (CID 170744979) is N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide.
What is the SMILES notation for N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide?
The canonical SMILES for N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide is C=C=CCC(=O)NCCCC[C@H](O)CO.
What is the InChIKey of N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide?
The InChIKey is OXEIGFIRZLZNAV-JTQLQIEISA-N. The full InChI is InChI=1S/C11H19NO3/c1-2-3-7-11(15)12-8-5-4-6-10(14)9-13/h3,10,13-14H,1,4-9H2,(H,12,15)/t10-/m0/s1.
What are the key properties of N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide?
N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide has a molecular weight of 213.28 g/mol, XLogP of 0.36, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S)-5,6-dihydroxyhexyl]penta-3,4-dienamide is sourced from PubChem (CID 170744979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).