C18H27N — CID 170745026
azane;[(2S)-2-methyl-3,7-dimethylidenenon-8-enyl]benzene (PubChem CID 170745026) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is azane;[(2S)-2-methyl-3,7-dimethylidenenon-8-enyl]benzene.
| Compound Name | azane;[(2S)-2-methyl-3,7-dimethylidenenon-8-enyl]benzene |
|---|---|
| PubChem CID | 170745026 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | azane;[(2S)-2-methyl-3,7-dimethylidenenon-8-enyl]benzene |
| SMILES | C=CC(=C)CCCC(=C)[C@@H](C)Cc1ccccc1.N |
| InChI | InChI=1S/C18H24.H3N/c1-5-15(2)10-9-11-16(3)17(4)14-18-12-7-6-8-13-18;/h5-8,12-13,17H,1-3,9-11,14H2,4H3;1H3/t17-;/m0./s1 |
| InChIKey | UEIFXXFMECGKKI-LMOVPXPDSA-N |
| XLogP | 5.50 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|