C28H34N6O — CID 170745936
(E)-3-amino-N-[(4-carbamimidoyl-3-ethynylphenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide;propane (PubChem CID 170745936) has the molecular formula C28H34N6O and a molecular weight of 470.62 g/mol. Its IUPAC name is (E)-3-amino-N-[(4-carbamimidoyl-3-ethynylphenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide;propane.
| Compound Name | (E)-3-amino-N-[(4-carbamimidoyl-3-ethynylphenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide;propane |
|---|---|
| PubChem CID | 170745936 |
| Molecular Formula | C28H34N6O |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | (E)-3-amino-N-[(4-carbamimidoyl-3-ethynylphenyl)methyl]-2-[[4-(2-cyanopropan-2-yl)phenyl]methyliminomethyl]prop-2-enamide;propane |
| SMILES | CCC.[H]/N=C(\N)c1ccc(CNC(=O)C(/C=N/Cc2ccc(C(C)(C)C#N)cc2)=C/N)cc1C#C |
| InChI | InChI=1S/C25H26N6O.C3H8/c1-4-19-11-18(7-10-22(19)23(28)29)14-31-24(32)20(12-26)15-30-13-17-5-8-21(9-6-17)25(2,3)16-27;1-3-2/h1,5-12,15H,13-14,26H2,2-3H3,(H3,28,29)(H,31,32);3H2,1-2H3/b20-12+,30-15+; |
| InChIKey | RSUXOEJWXYCZJU-SLJHLIHXSA-N |
| XLogP | 3.90 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|