C22H28O4 — CID 170746253
6,6-dimethyl-8-(oxan-4-yloxy)benzo[c]chromen-3-ol;ethane (PubChem CID 170746253) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 6,6-dimethyl-8-(oxan-4-yloxy)benzo[c]chromen-3-ol;ethane.
| Compound Name | 6,6-dimethyl-8-(oxan-4-yloxy)benzo[c]chromen-3-ol;ethane |
|---|---|
| PubChem CID | 170746253 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 6,6-dimethyl-8-(oxan-4-yloxy)benzo[c]chromen-3-ol;ethane |
| SMILES | CC.CC1(C)Oc2cc(O)ccc2-c2ccc(OC3CCOCC3)cc21 |
| InChI | InChI=1S/C20H22O4.C2H6/c1-20(2)18-12-15(23-14-7-9-22-10-8-14)4-6-16(18)17-5-3-13(21)11-19(17)24-20;1-2/h3-6,11-12,14,21H,7-10H2,1-2H3;1-2H3 |
| InChIKey | AEFJZQVEPFBBHU-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |