C23H22ClN7O2S — CID 170746671
4-amino-6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-N-(1-prop-2-enoylazetidin-3-yl)pyrimidine-5-carbothioamide (PubChem CID 170746671) has the molecular formula C23H22ClN7O2S and a molecular weight of 496.00 g/mol. Its IUPAC name is 4-amino-6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-N-(1-prop-2-enoylazetidin-3-yl)pyrimidine-5-carbothioamide.
| Compound Name | 4-amino-6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-N-(1-prop-2-enoylazetidin-3-yl)pyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 170746671 |
| Molecular Formula | C23H22ClN7O2S |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 4-amino-6-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-N-(1-prop-2-enoylazetidin-3-yl)pyrimidine-5-carbothioamide |
| SMILES | C=CC(=O)N1CC(NC(=S)c2c(N)ncnc2Nc2ccc(OCc3ccccn3)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H22ClN7O2S/c1-2-19(32)31-10-16(11-31)30-23(34)20-21(25)27-13-28-22(20)29-14-6-7-18(17(24)9-14)33-12-15-5-3-4-8-26-15/h2-9,13,16H,1,10-12H2,(H,30,34)(H3,25,27,28,29) |
| InChIKey | CXSQGTPZRDRTBH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|