C22H32NO6P — CID 170747292
2-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl]oxy]-4,6-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide (PubChem CID 170747292) has the molecular formula C22H32NO6P and a molecular weight of 437.47 g/mol. Its IUPAC name is 2-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl]oxy]-4,6-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide.
| Compound Name | 2-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl]oxy]-4,6-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| PubChem CID | 170747292 |
| Molecular Formula | C22H32NO6P |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[[3a-(3,4-dimethoxyphenyl)-1-methyl-3,4,5,7a-tetrahydro-2H-indol-6-yl]oxy]-4,6-dimethyl-1,3,2λ5-dioxaphosphinane 2-oxide |
| SMILES | COc1ccc(C23CCC(OP4(=O)OC(C)CC(C)O4)=CC2N(C)CC3)cc1OC |
| InChI | InChI=1S/C22H32NO6P/c1-15-12-16(2)28-30(24,27-15)29-18-8-9-22(10-11-23(3)21(22)14-18)17-6-7-19(25-4)20(13-17)26-5/h6-7,13-16,21H,8-12H2,1-5H3 |
| InChIKey | NZUWXMXIQCGDBR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|