C13H22NO4P — CID 170747325
2-[(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl)oxy]-1,3,2λ5-dioxaphosphepane 2-oxide (PubChem CID 170747325) has the molecular formula C13H22NO4P and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl)oxy]-1,3,2λ5-dioxaphosphepane 2-oxide.
| Compound Name | 2-[(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl)oxy]-1,3,2λ5-dioxaphosphepane 2-oxide |
|---|---|
| PubChem CID | 170747325 |
| Molecular Formula | C13H22NO4P |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[(1-methyl-2,3,3a,4,7,7a-hexahydroindol-6-yl)oxy]-1,3,2λ5-dioxaphosphepane 2-oxide |
| SMILES | CN1CCC2CC=C(OP3(=O)OCCCCO3)CC21 |
| InChI | InChI=1S/C13H22NO4P/c1-14-7-6-11-4-5-12(10-13(11)14)18-19(15)16-8-2-3-9-17-19/h5,11,13H,2-4,6-10H2,1H3 |
| InChIKey | HOCMNWVRDSPHRE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|