About (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one
(3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one (PubChem CID 170748077) has the molecular formula C9H6BrF3N2O2
and a molecular weight of 311.06 g/mol. Its IUPAC name is (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one.
Molecular Properties
| Compound Name | (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| PubChem CID | 170748077 |
| Molecular Formula | C9H6BrF3N2O2 |
| Molecular Weight | 311.06 g/mol |
| Exact Mass | 309.96 |
| IUPAC Name | (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| SMILES | C[C@H]1Oc2nc(Br)c(C(F)(F)F)cc2NC1=O |
| InChI | InChI=1S/C9H6BrF3N2O2/c1-3-7(16)14-5-2-4(9(11,12)13)6(10)15-8(5)17-3/h2-3H,1H3,(H,14,16)/t3-/m1/s1 |
| InChIKey | HULLFANGIFBCLY-GSVOUGTGSA-N |
| XLogP | 2.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.06 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one?
The IUPAC name of (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one (CID 170748077) is (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one.
What is the SMILES notation for (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one?
The canonical SMILES for (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one is C[C@H]1Oc2nc(Br)c(C(F)(F)F)cc2NC1=O.
What is the InChIKey of (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one?
The InChIKey is HULLFANGIFBCLY-GSVOUGTGSA-N. The full InChI is InChI=1S/C9H6BrF3N2O2/c1-3-7(16)14-5-2-4(9(11,12)13)6(10)15-8(5)17-3/h2-3H,1H3,(H,14,16)/t3-/m1/s1.
What are the key properties of (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one?
(3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one has a molecular weight of 311.06 g/mol, XLogP of 2.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-6-bromo-3-methyl-7-(trifluoromethyl)-1H-pyrido[2,3-b][1,4]oxazin-2-one is sourced from PubChem (CID 170748077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).