About (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one
(2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one (PubChem CID 170748523) has the molecular formula C18H17F3N2O3
and a molecular weight of 366.34 g/mol. Its IUPAC name is (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one |
| PubChem CID | 170748523 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one |
| SMILES | C[C@H]1Oc2cc(N)ccc2N([C@@H](C)c2cccc(OC(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H17F3N2O3/c1-10(12-4-3-5-14(8-12)26-18(19,20)21)23-15-7-6-13(22)9-16(15)25-11(2)17(23)24/h3-11H,22H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | GSMANZUCPMNGFY-WDEREUQCSA-N |
| XLogP | 4.04 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one?
The IUPAC name of (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one (CID 170748523) is (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one.
What is the SMILES notation for (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one?
The canonical SMILES for (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one is C[C@H]1Oc2cc(N)ccc2N([C@@H](C)c2cccc(OC(F)(F)F)c2)C1=O.
What is the InChIKey of (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one?
The InChIKey is GSMANZUCPMNGFY-WDEREUQCSA-N. The full InChI is InChI=1S/C18H17F3N2O3/c1-10(12-4-3-5-14(8-12)26-18(19,20)21)23-15-7-6-13(22)9-16(15)25-11(2)17(23)24/h3-11H,22H2,1-2H3/t10-,11+/m0/s1.
What are the key properties of (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one?
(2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one has a molecular weight of 366.34 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-amino-2-methyl-4-[(1S)-1-[3-(trifluoromethoxy)phenyl]ethyl]-1,4-benzoxazin-3-one is sourced from PubChem (CID 170748523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).