About 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate
7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate (PubChem CID 170748619) has the molecular formula C23H29N3O3
and a molecular weight of 395.50 g/mol. Its IUPAC name is 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate.
Molecular Properties
| Compound Name | 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate |
| PubChem CID | 170748619 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate |
| SMILES | CC(C)(C)OC#N.Cc1cccc(CN2C(=O)C(C)(C)Oc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C18H20N2O2.C5H9NO/c1-12-5-4-6-13(9-12)11-20-15-8-7-14(19)10-16(15)22-18(2,3)17(20)21;1-5(2,3)7-4-6/h4-10H,11,19H2,1-3H3;1-3H3 |
| InChIKey | PBYRWKHKCKEEBS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate?
The IUPAC name of 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate (CID 170748619) is 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate.
What is the SMILES notation for 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate?
The canonical SMILES for 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate is CC(C)(C)OC#N.Cc1cccc(CN2C(=O)C(C)(C)Oc3cc(N)ccc32)c1.
What is the InChIKey of 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate?
The InChIKey is PBYRWKHKCKEEBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2.C5H9NO/c1-12-5-4-6-13(9-12)11-20-15-8-7-14(19)10-16(15)22-18(2,3)17(20)21;1-5(2,3)7-4-6/h4-10H,11,19H2,1-3H3;1-3H3.
What are the key properties of 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate?
7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate has a molecular weight of 395.50 g/mol, XLogP of 4.56, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2,2-dimethyl-4-[(3-methylphenyl)methyl]-1,4-benzoxazin-3-one;tert-butyl cyanate is sourced from PubChem (CID 170748619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).