About N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane (PubChem CID 170749929) has the molecular formula C19H29FN2O3
and a molecular weight of 352.45 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane.
Molecular Properties
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane |
| PubChem CID | 170749929 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane |
| SMILES | CC.CC.CC(C)c1ccc(C(=O)NC2CCC(=O)NC2=O)c(F)c1 |
| InChI | InChI=1S/C15H17FN2O3.2C2H6/c1-8(2)9-3-4-10(11(16)7-9)14(20)17-12-5-6-13(19)18-15(12)21;2*1-2/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,20)(H,18,19,21);2*1-2H3 |
| InChIKey | RSWCJDOEZNJWJX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane?
The IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane (CID 170749929) is N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane.
What is the SMILES notation for N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane?
The canonical SMILES for N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane is CC.CC.CC(C)c1ccc(C(=O)NC2CCC(=O)NC2=O)c(F)c1.
What is the InChIKey of N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane?
The InChIKey is RSWCJDOEZNJWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN2O3.2C2H6/c1-8(2)9-3-4-10(11(16)7-9)14(20)17-12-5-6-13(19)18-15(12)21;2*1-2/h3-4,7-8,12H,5-6H2,1-2H3,(H,17,20)(H,18,19,21);2*1-2H3.
What are the key properties of N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane?
N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane has a molecular weight of 352.45 g/mol, XLogP of 3.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dioxopiperidin-3-yl)-2-fluoro-4-propan-2-ylbenzamide;ethane is sourced from PubChem (CID 170749929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).