C28H20ClF9N4 — CID 170750405
1-(2-chloro-5-fluorophenyl)-7-N-[1-[3-fluoro-5-(trifluoromethyl)phenyl]ethenyl]-3-methylidene-5-[N-methyl-C-(1,2,2,2-tetrafluoroethyl)carbonimidoyl]-1,2-dihydroisoindole-4,7-diamine (PubChem CID 170750405) has the molecular formula C28H20ClF9N4 and a molecular weight of 618.93 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-7-N-[1-[3-fluoro-5-(trifluoromethyl)phenyl]ethenyl]-3-methylidene-5-[N-methyl-C-(1,2,2,2-tetrafluoroethyl)carbonimidoyl]-1,2-dihydroisoindole-4,7-diamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-7-N-[1-[3-fluoro-5-(trifluoromethyl)phenyl]ethenyl]-3-methylidene-5-[N-methyl-C-(1,2,2,2-tetrafluoroethyl)carbonimidoyl]-1,2-dihydroisoindole-4,7-diamine |
|---|---|
| PubChem CID | 170750405 |
| Molecular Formula | C28H20ClF9N4 |
| Molecular Weight | 618.93 g/mol |
| Exact Mass | 618.12 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-7-N-[1-[3-fluoro-5-(trifluoromethyl)phenyl]ethenyl]-3-methylidene-5-[N-methyl-C-(1,2,2,2-tetrafluoroethyl)carbonimidoyl]-1,2-dihydroisoindole-4,7-diamine |
| SMILES | C=C(Nc1cc(/C(=N/C)C(F)C(F)(F)F)c(N)c2c1C(c1cc(F)ccc1Cl)NC2=C)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H20ClF9N4/c1-11(13-6-14(27(33,34)35)8-16(31)7-13)41-20-10-18(25(40-3)26(32)28(36,37)38)23(39)21-12(2)42-24(22(20)21)17-9-15(30)4-5-19(17)29/h4-10,24,26,41-42H,1-2,39H2,3H3/b40-25- |
| InChIKey | GGBAXNJGNOUBKB-QNHWSJEBSA-N |
| XLogP | 8.28 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.93 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|