C27H37NO — CID 170752393
3-[(1R,2S,3R)-2-[(Z)-but-1-enyl]-1-ethyl-3-[methyl(2-phenylethyl)amino]cyclohexyl]phenol (PubChem CID 170752393) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is 3-[(1R,2S,3R)-2-[(Z)-but-1-enyl]-1-ethyl-3-[methyl(2-phenylethyl)amino]cyclohexyl]phenol.
| Compound Name | 3-[(1R,2S,3R)-2-[(Z)-but-1-enyl]-1-ethyl-3-[methyl(2-phenylethyl)amino]cyclohexyl]phenol |
|---|---|
| PubChem CID | 170752393 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | 3-[(1R,2S,3R)-2-[(Z)-but-1-enyl]-1-ethyl-3-[methyl(2-phenylethyl)amino]cyclohexyl]phenol |
| SMILES | CC/C=C\[C@@H]1[C@H](N(C)CCc2ccccc2)CCC[C@@]1(CC)c1cccc(O)c1 |
| InChI | InChI=1S/C27H37NO/c1-4-6-16-25-26(28(3)20-18-22-12-8-7-9-13-22)17-11-19-27(25,5-2)23-14-10-15-24(29)21-23/h6-10,12-16,21,25-26,29H,4-5,11,17-20H2,1-3H3/b16-6-/t25-,26-,27+/m1/s1 |
| InChIKey | LHRJDBVKIADPQE-DHULKTLISA-N |
| XLogP | 6.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|