C21H32N2O2 — CID 170752474
2-cyclohexyl-5-methyl-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-oxazole-4-carboxamide (PubChem CID 170752474) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-cyclohexyl-5-methyl-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 170752474 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-cyclohexyl-5-methyl-N-[(1R,2R,3R,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1oc(C2CCCCC2)nc1C(=O)N[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C21H32N2O2/c1-12-16-10-15(21(16,3)4)11-17(12)22-19(24)18-13(2)25-20(23-18)14-8-6-5-7-9-14/h12,14-17H,5-11H2,1-4H3,(H,22,24)/t12-,15+,16-,17-/m1/s1 |
| InChIKey | TWLRZILTRHMOEH-VJUNAUMWSA-N |
| XLogP | 4.83 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |