C26H26N4O3 — CID 170752525
(3S)-3-[bis[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]azepan-2-one (PubChem CID 170752525) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is (3S)-3-[bis[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]azepan-2-one.
| Compound Name | (3S)-3-[bis[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]azepan-2-one |
|---|---|
| PubChem CID | 170752525 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | (3S)-3-[bis[(5-phenyl-1,2-oxazol-3-yl)methyl]amino]azepan-2-one |
| SMILES | O=C1NCCCC[C@@H]1N(Cc1cc(-c2ccccc2)on1)Cc1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C26H26N4O3/c31-26-23(13-7-8-14-27-26)30(17-21-15-24(32-28-21)19-9-3-1-4-10-19)18-22-16-25(33-29-22)20-11-5-2-6-12-20/h1-6,9-12,15-16,23H,7-8,13-14,17-18H2,(H,27,31)/t23-/m0/s1 |
| InChIKey | ZBRGTGNDTGXTSK-QHCPKHFHSA-N |
| XLogP | 4.67 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |