C20H27N3O — CID 170752611
(1R,2R,5S)-2,6,6-trimethyl-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]bicyclo[3.1.1]heptan-3-amine (PubChem CID 170752611) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is (1R,2R,5S)-2,6,6-trimethyl-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]bicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,5S)-2,6,6-trimethyl-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]bicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 170752611 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | (1R,2R,5S)-2,6,6-trimethyl-N-[2-(5-phenyl-1,2,4-oxadiazol-3-yl)ethyl]bicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@H]1C(NCCc2noc(-c3ccccc3)n2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C20H27N3O/c1-13-16-11-15(20(16,2)3)12-17(13)21-10-9-18-22-19(24-23-18)14-7-5-4-6-8-14/h4-8,13,15-17,21H,9-12H2,1-3H3/t13-,15+,16-,17?/m1/s1 |
| InChIKey | KAKHFCVPBOBKNV-FGKSTEJMSA-N |
| XLogP | 3.94 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |