About 3,3-difluorothiolane;ethane
3,3-difluorothiolane;ethane (PubChem CID 170752732) has the molecular formula C6H12F2S
and a molecular weight of 154.22 g/mol. Its IUPAC name is 3,3-difluorothiolane;ethane.
Molecular Properties
| Compound Name | 3,3-difluorothiolane;ethane |
| PubChem CID | 170752732 |
| Molecular Formula | C6H12F2S |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 3,3-difluorothiolane;ethane |
| SMILES | CC.FC1(F)CCSC1 |
| InChI | InChI=1S/C4H6F2S.C2H6/c5-4(6)1-2-7-3-4;1-2/h1-3H2;1-2H3 |
| InChIKey | NNJJNQOJBHQTSG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-difluorothiolane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluorothiolane;ethane?
The IUPAC name of 3,3-difluorothiolane;ethane (CID 170752732) is 3,3-difluorothiolane;ethane.
What is the SMILES notation for 3,3-difluorothiolane;ethane?
The canonical SMILES for 3,3-difluorothiolane;ethane is CC.FC1(F)CCSC1.
What is the InChIKey of 3,3-difluorothiolane;ethane?
The InChIKey is NNJJNQOJBHQTSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2S.C2H6/c5-4(6)1-2-7-3-4;1-2/h1-3H2;1-2H3.
What are the key properties of 3,3-difluorothiolane;ethane?
3,3-difluorothiolane;ethane has a molecular weight of 154.22 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluorothiolane;ethane is sourced from PubChem (CID 170752732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).