About 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane
2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane (PubChem CID 170752779) has the molecular formula C17H21F3N2O
and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane.
Molecular Properties
| Compound Name | 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane |
| PubChem CID | 170752779 |
| Molecular Formula | C17H21F3N2O |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane |
| SMILES | CC.Fc1cnccc1Cc1coc(C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C15H15F3N2O.C2H6/c16-13-8-19-6-3-11(13)7-12-9-21-14(20-12)10-1-4-15(17,18)5-2-10;1-2/h3,6,8-10H,1-2,4-5,7H2;1-2H3 |
| InChIKey | WBHRNZNVYLMUMN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane?
The IUPAC name of 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane (CID 170752779) is 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane.
What is the SMILES notation for 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane?
The canonical SMILES for 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane is CC.Fc1cnccc1Cc1coc(C2CCC(F)(F)CC2)n1.
What is the InChIKey of 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane?
The InChIKey is WBHRNZNVYLMUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F3N2O.C2H6/c16-13-8-19-6-3-11(13)7-12-9-21-14(20-12)10-1-4-15(17,18)5-2-10;1-2/h3,6,8-10H,1-2,4-5,7H2;1-2H3.
What are the key properties of 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane?
2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane has a molecular weight of 326.36 g/mol, XLogP of 5.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-difluorocyclohexyl)-4-[(3-fluoro-4-pyridinyl)methyl]-1,3-oxazole;ethane is sourced from PubChem (CID 170752779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).