About 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile
8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile (PubChem CID 170753057) has the molecular formula C11H5BrCl2N2
and a molecular weight of 315.99 g/mol. Its IUPAC name is 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile.
Molecular Properties
| Compound Name | 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile |
| PubChem CID | 170753057 |
| Molecular Formula | C11H5BrCl2N2 |
| Molecular Weight | 315.99 g/mol |
| Exact Mass | 313.90 |
| IUPAC Name | 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile |
| SMILES | Cc1c(Cl)nc2c(Br)cc(Cl)cc2c1C#N |
| InChI | InChI=1S/C11H5BrCl2N2/c1-5-8(4-15)7-2-6(13)3-9(12)10(7)16-11(5)14/h2-3H,1H3 |
| InChIKey | SZMNGYUSLJWAQZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.99 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile?
The IUPAC name of 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile (CID 170753057) is 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile.
What is the SMILES notation for 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile?
The canonical SMILES for 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile is Cc1c(Cl)nc2c(Br)cc(Cl)cc2c1C#N.
What is the InChIKey of 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile?
The InChIKey is SZMNGYUSLJWAQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5BrCl2N2/c1-5-8(4-15)7-2-6(13)3-9(12)10(7)16-11(5)14/h2-3H,1H3.
What are the key properties of 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile?
8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile has a molecular weight of 315.99 g/mol, XLogP of 4.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2,6-dichloro-3-methylquinoline-4-carbonitrile is sourced from PubChem (CID 170753057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).