C20H28N4O2 — CID 170753768
8-(1-aminoethyl)-3-(cyclobutylmethyl)-6-methyl-2-morpholin-4-ylquinazolin-4-one (PubChem CID 170753768) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 8-(1-aminoethyl)-3-(cyclobutylmethyl)-6-methyl-2-morpholin-4-ylquinazolin-4-one.
| Compound Name | 8-(1-aminoethyl)-3-(cyclobutylmethyl)-6-methyl-2-morpholin-4-ylquinazolin-4-one |
|---|---|
| PubChem CID | 170753768 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 8-(1-aminoethyl)-3-(cyclobutylmethyl)-6-methyl-2-morpholin-4-ylquinazolin-4-one |
| SMILES | Cc1cc(C(C)N)c2nc(N3CCOCC3)n(CC3CCC3)c(=O)c2c1 |
| InChI | InChI=1S/C20H28N4O2/c1-13-10-16(14(2)21)18-17(11-13)19(25)24(12-15-4-3-5-15)20(22-18)23-6-8-26-9-7-23/h10-11,14-15H,3-9,12,21H2,1-2H3 |
| InChIKey | AFRCUWSWXAJOCB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |