C22H25N5O3S — CID 170754131
N'-[[1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]amino]sulfanyl-2,2-dimethylpropanehydrazide (PubChem CID 170754131) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is N'-[[1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]amino]sulfanyl-2,2-dimethylpropanehydrazide.
| Compound Name | N'-[[1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]amino]sulfanyl-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 170754131 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N'-[[1-cyano-2-[4-(3-methyl-2-oxo-1,3-benzoxazol-5-yl)phenyl]ethyl]amino]sulfanyl-2,2-dimethylpropanehydrazide |
| SMILES | Cn1c(=O)oc2ccc(-c3ccc(CC(C#N)NSNNC(=O)C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C22H25N5O3S/c1-22(2,3)20(28)24-26-31-25-17(13-23)11-14-5-7-15(8-6-14)16-9-10-19-18(12-16)27(4)21(29)30-19/h5-10,12,17,25-26H,11H2,1-4H3,(H,24,28) |
| InChIKey | ZSOQJXGHNUFCTB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|