About 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one
3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one (PubChem CID 170754533) has the molecular formula C19H21N3O2S
and a molecular weight of 355.46 g/mol. Its IUPAC name is 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one |
| PubChem CID | 170754533 |
| Molecular Formula | C19H21N3O2S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one |
| SMILES | CSC(N)CC#N.Cc1ccc(-c2ccc3oc(=O)n(C)c3c2)cc1 |
| InChI | InChI=1S/C15H13NO2.C4H8N2S/c1-10-3-5-11(6-4-10)12-7-8-14-13(9-12)16(2)15(17)18-14;1-7-4(6)2-3-5/h3-9H,1-2H3;4H,2,6H2,1H3 |
| InChIKey | PLFFQLDDFNMQNW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one?
The IUPAC name of 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one (CID 170754533) is 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one?
The canonical SMILES for 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one is CSC(N)CC#N.Cc1ccc(-c2ccc3oc(=O)n(C)c3c2)cc1.
What is the InChIKey of 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one?
The InChIKey is PLFFQLDDFNMQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2.C4H8N2S/c1-10-3-5-11(6-4-10)12-7-8-14-13(9-12)16(2)15(17)18-14;1-7-4(6)2-3-5/h3-9H,1-2H3;4H,2,6H2,1H3.
What are the key properties of 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one?
3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one has a molecular weight of 355.46 g/mol, XLogP of 3.65, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-methylsulfanylpropanenitrile;3-methyl-5-(4-methylphenyl)-1,3-benzoxazol-2-one is sourced from PubChem (CID 170754533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).