C8H11N3O — CID 170754700
N-(cyanomethyl)-1,2,3,6-tetrahydropyridine-3-carboxamide (PubChem CID 170754700) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is N-(cyanomethyl)-1,2,3,6-tetrahydropyridine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-1,2,3,6-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 170754700 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | N-(cyanomethyl)-1,2,3,6-tetrahydropyridine-3-carboxamide |
| SMILES | N#CCNC(=O)C1C=CCNC1 |
| InChI | InChI=1S/C8H11N3O/c9-3-5-11-8(12)7-2-1-4-10-6-7/h1-2,7,10H,4-6H2,(H,11,12) |
| InChIKey | MLSXGHYMMYGPDD-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|