C29H40N4O2 — CID 170754760
3-acetyl-1-cyclopentyl-4,6-dimethyl-5-[(Z)-1-[[(3Z,5Z)-5-piperidin-4-ylhepta-1,3,5-trien-2-yl]amino]ethenyliminomethyl]pyridin-2-one (PubChem CID 170754760) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is 3-acetyl-1-cyclopentyl-4,6-dimethyl-5-[(Z)-1-[[(3Z,5Z)-5-piperidin-4-ylhepta-1,3,5-trien-2-yl]amino]ethenyliminomethyl]pyridin-2-one.
| Compound Name | 3-acetyl-1-cyclopentyl-4,6-dimethyl-5-[(Z)-1-[[(3Z,5Z)-5-piperidin-4-ylhepta-1,3,5-trien-2-yl]amino]ethenyliminomethyl]pyridin-2-one |
|---|---|
| PubChem CID | 170754760 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | 3-acetyl-1-cyclopentyl-4,6-dimethyl-5-[(Z)-1-[[(3Z,5Z)-5-piperidin-4-ylhepta-1,3,5-trien-2-yl]amino]ethenyliminomethyl]pyridin-2-one |
| SMILES | C=C(/C=C\C(=C/C)C1CCNCC1)NC(=C)/N=C\c1c(C)c(C(C)=O)c(=O)n(C2CCCC2)c1C |
| InChI | InChI=1S/C29H40N4O2/c1-7-24(25-14-16-30-17-15-25)13-12-19(2)32-23(6)31-18-27-20(3)28(22(5)34)29(35)33(21(27)4)26-10-8-9-11-26/h7,12-13,18,25-26,30,32H,2,6,8-11,14-17H2,1,3-5H3/b13-12-,24-7+,31-18- |
| InChIKey | OWDQZUMXWAJOHS-NLPYXYEZSA-N |
| XLogP | 5.28 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|