About 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one
2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one (PubChem CID 170755576) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one.
Molecular Properties
| Compound Name | 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one |
| PubChem CID | 170755576 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one |
| SMILES | CCCC(=O)N1CCCCC1.CCCC(CC)CO |
| InChI | InChI=1S/C9H17NO.C7H16O/c1-2-6-9(11)10-7-4-3-5-8-10;1-3-5-7(4-2)6-8/h2-8H2,1H3;7-8H,3-6H2,1-2H3 |
| InChIKey | MUDSMWCGQOMEGO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one?
The IUPAC name of 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one (CID 170755576) is 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one.
What is the SMILES notation for 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one?
The canonical SMILES for 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one is CCCC(=O)N1CCCCC1.CCCC(CC)CO.
What is the InChIKey of 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one?
The InChIKey is MUDSMWCGQOMEGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C7H16O/c1-2-6-9(11)10-7-4-3-5-8-10;1-3-5-7(4-2)6-8/h2-8H2,1H3;7-8H,3-6H2,1-2H3.
What are the key properties of 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one?
2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one has a molecular weight of 271.44 g/mol, XLogP of 3.60, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpentan-1-ol;1-piperidin-1-ylbutan-1-one is sourced from PubChem (CID 170755576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).