C11H21F3N2O3 — CID 170755651
2-acetamido-N-methyl-3-(2,2,2-trifluoroethoxy)butanamide;ethane (PubChem CID 170755651) has the molecular formula C11H21F3N2O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 2-acetamido-N-methyl-3-(2,2,2-trifluoroethoxy)butanamide;ethane.
| Compound Name | 2-acetamido-N-methyl-3-(2,2,2-trifluoroethoxy)butanamide;ethane |
|---|---|
| PubChem CID | 170755651 |
| Molecular Formula | C11H21F3N2O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-acetamido-N-methyl-3-(2,2,2-trifluoroethoxy)butanamide;ethane |
| SMILES | CC.CNC(=O)C(NC(C)=O)C(C)OCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O3.C2H6/c1-5(17-4-9(10,11)12)7(8(16)13-3)14-6(2)15;1-2/h5,7H,4H2,1-3H3,(H,13,16)(H,14,15);1-2H3 |
| InChIKey | SQEWPGIJXAQCPE-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |